C8H15N2O11P3 — CID 25243235
2-(2,4-dioxopyrimidin-1-yl)ethoxymethyl-[[hydroxy(phosphonooxy)phosphoryl]methyl]phosphinic acid (PubChem CID 25243235) has the molecular formula C8H15N2O11P3 and a molecular weight of 408.13 g/mol. Its IUPAC name is 2-(2,4-dioxopyrimidin-1-yl)ethoxymethyl-[[hydroxy(phosphonooxy)phosphoryl]methyl]phosphinic acid.
| Compound Name | 2-(2,4-dioxopyrimidin-1-yl)ethoxymethyl-[[hydroxy(phosphonooxy)phosphoryl]methyl]phosphinic acid |
|---|---|
| PubChem CID | 25243235 |
| Molecular Formula | C8H15N2O11P3 |
| Molecular Weight | 408.13 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | 2-(2,4-dioxopyrimidin-1-yl)ethoxymethyl-[[hydroxy(phosphonooxy)phosphoryl]methyl]phosphinic acid |
| SMILES | O=c1ccn(CCOCP(=O)(O)CP(=O)(O)OP(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C8H15N2O11P3/c11-7-1-2-10(8(12)9-7)3-4-20-5-22(13,14)6-23(15,16)21-24(17,18)19/h1-2H,3-6H2,(H,13,14)(H,15,16)(H,9,11,12)(H2,17,18,19) |
| InChIKey | FYSNAHQPGDYTND-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 205.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.13 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|