C11H19N2O7P — CID 146549589
[2-[2-(2,4-dioxopyrimidin-1-yl)ethoxy]-3-methoxypropoxy]-methylphosphinic acid (PubChem CID 146549589) has the molecular formula C11H19N2O7P and a molecular weight of 322.25 g/mol. Its IUPAC name is [2-[2-(2,4-dioxopyrimidin-1-yl)ethoxy]-3-methoxypropoxy]-methylphosphinic acid.
| Compound Name | [2-[2-(2,4-dioxopyrimidin-1-yl)ethoxy]-3-methoxypropoxy]-methylphosphinic acid |
|---|---|
| PubChem CID | 146549589 |
| Molecular Formula | C11H19N2O7P |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | [2-[2-(2,4-dioxopyrimidin-1-yl)ethoxy]-3-methoxypropoxy]-methylphosphinic acid |
| SMILES | COCC(COP(C)(=O)O)OCCn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C11H19N2O7P/c1-18-7-9(8-20-21(2,16)17)19-6-5-13-4-3-10(14)12-11(13)15/h3-4,9H,5-8H2,1-2H3,(H,16,17)(H,12,14,15) |
| InChIKey | FKVIBGANZRMWCB-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|