C10H17N2O7P — CID 10638490
[(3R,4S)-3-[(2,4-dioxopyrimidin-1-yl)methoxy]-4-hydroxypentyl]phosphonic acid (PubChem CID 10638490) has the molecular formula C10H17N2O7P and a molecular weight of 308.23 g/mol. Its IUPAC name is [(3R,4S)-3-[(2,4-dioxopyrimidin-1-yl)methoxy]-4-hydroxypentyl]phosphonic acid.
| Compound Name | [(3R,4S)-3-[(2,4-dioxopyrimidin-1-yl)methoxy]-4-hydroxypentyl]phosphonic acid |
|---|---|
| PubChem CID | 10638490 |
| Molecular Formula | C10H17N2O7P |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | [(3R,4S)-3-[(2,4-dioxopyrimidin-1-yl)methoxy]-4-hydroxypentyl]phosphonic acid |
| SMILES | C[C@H](O)[C@@H](CCP(=O)(O)O)OCn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H17N2O7P/c1-7(13)8(3-5-20(16,17)18)19-6-12-4-2-9(14)11-10(12)15/h2,4,7-8,13H,3,5-6H2,1H3,(H,11,14,15)(H2,16,17,18)/t7-,8+/m0/s1 |
| InChIKey | HKLNARHUHSCNHT-JGVFFNPUSA-N |
| XLogP | -1.17 |
| TPSA | 141.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|