C14H23N2O6P — CID 122447940
[(E)-4-(2,4-dioxopyrimidin-1-yl)but-2-enyl]-(3-propan-2-yloxypropoxy)phosphinic acid (PubChem CID 122447940) has the molecular formula C14H23N2O6P and a molecular weight of 346.32 g/mol. Its IUPAC name is [(E)-4-(2,4-dioxopyrimidin-1-yl)but-2-enyl]-(3-propan-2-yloxypropoxy)phosphinic acid.
| Compound Name | [(E)-4-(2,4-dioxopyrimidin-1-yl)but-2-enyl]-(3-propan-2-yloxypropoxy)phosphinic acid |
|---|---|
| PubChem CID | 122447940 |
| Molecular Formula | C14H23N2O6P |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | [(E)-4-(2,4-dioxopyrimidin-1-yl)but-2-enyl]-(3-propan-2-yloxypropoxy)phosphinic acid |
| SMILES | CC(C)OCCCOP(=O)(O)C/C=C/Cn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C14H23N2O6P/c1-12(2)21-9-5-10-22-23(19,20)11-4-3-7-16-8-6-13(17)15-14(16)18/h3-4,6,8,12H,5,7,9-11H2,1-2H3,(H,19,20)(H,15,17,18)/b4-3+ |
| InChIKey | OMPWVUILTKJDQN-ONEGZZNKSA-N |
| XLogP | 1.11 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|