C18H28N4O9P2 — CID 91326769
5-(2,4-dioxopyrimidin-1-yl)pentyl-[5-(2,4-dioxopyrimidin-1-yl)pentyl-hydroxyphosphoryl]oxyphosphinic acid (PubChem CID 91326769) has the molecular formula C18H28N4O9P2 and a molecular weight of 506.39 g/mol. Its IUPAC name is 5-(2,4-dioxopyrimidin-1-yl)pentyl-[5-(2,4-dioxopyrimidin-1-yl)pentyl-hydroxyphosphoryl]oxyphosphinic acid.
| Compound Name | 5-(2,4-dioxopyrimidin-1-yl)pentyl-[5-(2,4-dioxopyrimidin-1-yl)pentyl-hydroxyphosphoryl]oxyphosphinic acid |
|---|---|
| PubChem CID | 91326769 |
| Molecular Formula | C18H28N4O9P2 |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 5-(2,4-dioxopyrimidin-1-yl)pentyl-[5-(2,4-dioxopyrimidin-1-yl)pentyl-hydroxyphosphoryl]oxyphosphinic acid |
| SMILES | O=c1ccn(CCCCCP(=O)(O)OP(=O)(O)CCCCCn2ccc(=O)[nH]c2=O)c(=O)[nH]1 |
| InChI | InChI=1S/C18H28N4O9P2/c23-15-7-11-21(17(25)19-15)9-3-1-5-13-32(27,28)31-33(29,30)14-6-2-4-10-22-12-8-16(24)20-18(22)26/h7-8,11-12H,1-6,9-10,13-14H2,(H,27,28)(H,29,30)(H,19,23,25)(H,20,24,26) |
| InChIKey | ZPKFEWJQOXFOBT-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 193.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|