C9H15N2O3Pd- — CID 178051996
1-butylpyrimidine-2,4-dione;methanol;palladium (PubChem CID 178051996) has the molecular formula C9H15N2O3Pd- and a molecular weight of 305.65 g/mol. Its IUPAC name is 1-butylpyrimidine-2,4-dione;methanol;palladium.
| Compound Name | 1-butylpyrimidine-2,4-dione;methanol;palladium |
|---|---|
| PubChem CID | 178051996 |
| Molecular Formula | C9H15N2O3Pd- |
| Molecular Weight | 305.65 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 1-butylpyrimidine-2,4-dione;methanol;palladium |
| SMILES | CO.[CH2-]CCCn1ccc(=O)[nH]c1=O.[Pd] |
| InChI | InChI=1S/C8H11N2O2.CH4O.Pd/c1-2-3-5-10-6-4-7(11)9-8(10)12;1-2;/h4,6H,1-3,5H2,(H,9,11,12);2H,1H3;/q-1;; |
| InChIKey | NGSVWIIDKUVZBO-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.65 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|