C10H16Cl2N2O2Si — CID 10541882
1-[3-[bis(chloromethyl)-methylsilyl]propyl]pyrimidine-2,4-dione (PubChem CID 10541882) has the molecular formula C10H16Cl2N2O2Si and a molecular weight of 295.24 g/mol. Its IUPAC name is 1-[3-[bis(chloromethyl)-methylsilyl]propyl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-[bis(chloromethyl)-methylsilyl]propyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10541882 |
| Molecular Formula | C10H16Cl2N2O2Si |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 1-[3-[bis(chloromethyl)-methylsilyl]propyl]pyrimidine-2,4-dione |
| SMILES | C[Si](CCl)(CCl)CCCn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H16Cl2N2O2Si/c1-17(7-11,8-12)6-2-4-14-5-3-9(15)13-10(14)16/h3,5H,2,4,6-8H2,1H3,(H,13,15,16) |
| InChIKey | MRAPCHRRUIBWLS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|