C5H6N2O2Se — CID 173469434
1-(selanylmethyl)pyrimidine-2,4-dione (PubChem CID 173469434) has the molecular formula C5H6N2O2Se and a molecular weight of 205.07 g/mol. Its IUPAC name is 1-(selanylmethyl)pyrimidine-2,4-dione.
| Compound Name | 1-(selanylmethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 173469434 |
| Molecular Formula | C5H6N2O2Se |
| Molecular Weight | 205.07 g/mol |
| Exact Mass | 205.96 |
| IUPAC Name | 1-(selanylmethyl)pyrimidine-2,4-dione |
| SMILES | O=c1ccn(C[SeH])c(=O)[nH]1 |
| InChI | InChI=1S/C5H6N2O2Se/c8-4-1-2-7(3-10)5(9)6-4/h1-2,10H,3H2,(H,6,8,9) |
| InChIKey | CHAOZOBXXYCPBI-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.07 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|