C7H9ClN2O3 — CID 10104376
1-(2-chloroethoxymethyl)pyrimidine-2,4-dione (PubChem CID 10104376) has the molecular formula C7H9ClN2O3 and a molecular weight of 204.61 g/mol. Its IUPAC name is 1-(2-chloroethoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 1-(2-chloroethoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10104376 |
| Molecular Formula | C7H9ClN2O3 |
| Molecular Weight | 204.61 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 1-(2-chloroethoxymethyl)pyrimidine-2,4-dione |
| SMILES | O=c1ccn(COCCCl)c(=O)[nH]1 |
| InChI | InChI=1S/C7H9ClN2O3/c8-2-4-13-5-10-3-1-6(11)9-7(10)12/h1,3H,2,4-5H2,(H,9,11,12) |
| InChIKey | OAZYDBBUBRXSLZ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.61 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|