C17H21ClN2O5S — CID 58218290
1-[3-[(2R)-2-(2-chlorophenyl)propyl]sulfonylpropoxymethyl]pyrimidine-2,4-dione (PubChem CID 58218290) has the molecular formula C17H21ClN2O5S and a molecular weight of 400.88 g/mol. Its IUPAC name is 1-[3-[(2R)-2-(2-chlorophenyl)propyl]sulfonylpropoxymethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-[(2R)-2-(2-chlorophenyl)propyl]sulfonylpropoxymethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58218290 |
| Molecular Formula | C17H21ClN2O5S |
| Molecular Weight | 400.88 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 1-[3-[(2R)-2-(2-chlorophenyl)propyl]sulfonylpropoxymethyl]pyrimidine-2,4-dione |
| SMILES | C[C@@H](CS(=O)(=O)CCCOCn1ccc(=O)[nH]c1=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H21ClN2O5S/c1-13(14-5-2-3-6-15(14)18)11-26(23,24)10-4-9-25-12-20-8-7-16(21)19-17(20)22/h2-3,5-8,13H,4,9-12H2,1H3,(H,19,21,22)/t13-/m0/s1 |
| InChIKey | HWAXLAGQTJQSOT-ZDUSSCGKSA-N |
| XLogP | 1.77 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.88 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|