C22H25N3O5S — CID 67022128
3-[(2,4-dioxopyrimidin-1-yl)methoxy]-N-[(2-methylphenyl)-phenylmethyl]propane-1-sulfonamide (PubChem CID 67022128) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is 3-[(2,4-dioxopyrimidin-1-yl)methoxy]-N-[(2-methylphenyl)-phenylmethyl]propane-1-sulfonamide.
| Compound Name | 3-[(2,4-dioxopyrimidin-1-yl)methoxy]-N-[(2-methylphenyl)-phenylmethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 67022128 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 3-[(2,4-dioxopyrimidin-1-yl)methoxy]-N-[(2-methylphenyl)-phenylmethyl]propane-1-sulfonamide |
| SMILES | Cc1ccccc1C(NS(=O)(=O)CCCOCn1ccc(=O)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C22H25N3O5S/c1-17-8-5-6-11-19(17)21(18-9-3-2-4-10-18)24-31(28,29)15-7-14-30-16-25-13-12-20(26)23-22(25)27/h2-6,8-13,21,24H,7,14-16H2,1H3,(H,23,26,27) |
| InChIKey | MXVBGEURZJAHLF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|