C22H23NO2S — CID 28573215
1-(4-methylphenyl)-N-[(R)-(2-methylphenyl)-phenylmethyl]methanesulfonamide (PubChem CID 28573215) has the molecular formula C22H23NO2S and a molecular weight of 365.50 g/mol. Its IUPAC name is 1-(4-methylphenyl)-N-[(R)-(2-methylphenyl)-phenylmethyl]methanesulfonamide.
| Compound Name | 1-(4-methylphenyl)-N-[(R)-(2-methylphenyl)-phenylmethyl]methanesulfonamide |
|---|---|
| PubChem CID | 28573215 |
| Molecular Formula | C22H23NO2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-(4-methylphenyl)-N-[(R)-(2-methylphenyl)-phenylmethyl]methanesulfonamide |
| SMILES | Cc1ccc(CS(=O)(=O)N[C@H](c2ccccc2)c2ccccc2C)cc1 |
| InChI | InChI=1S/C22H23NO2S/c1-17-12-14-19(15-13-17)16-26(24,25)23-22(20-9-4-3-5-10-20)21-11-7-6-8-18(21)2/h3-15,22-23H,16H2,1-2H3/t22-/m1/s1 |
| InChIKey | GEPLRDIRKWONAT-JOCHJYFZSA-N |
| XLogP | 4.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |