C16H19NO2S — CID 95706524
N-[(S)-(2,4-dimethylphenyl)-phenylmethyl]methanesulfonamide (PubChem CID 95706524) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is N-[(S)-(2,4-dimethylphenyl)-phenylmethyl]methanesulfonamide.
| Compound Name | N-[(S)-(2,4-dimethylphenyl)-phenylmethyl]methanesulfonamide |
|---|---|
| PubChem CID | 95706524 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-[(S)-(2,4-dimethylphenyl)-phenylmethyl]methanesulfonamide |
| SMILES | Cc1ccc([C@@H](NS(C)(=O)=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C16H19NO2S/c1-12-9-10-15(13(2)11-12)16(17-20(3,18)19)14-7-5-4-6-8-14/h4-11,16-17H,1-3H3/t16-/m0/s1 |
| InChIKey | PKYDWKKQORZBKE-INIZCTEOSA-N |
| XLogP | 2.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |