C24H25NO — CID 133200142
N-[(2,4-dimethylphenyl)-phenylmethyl]-2,5-dimethylbenzamide (PubChem CID 133200142) has the molecular formula C24H25NO and a molecular weight of 343.47 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)-phenylmethyl]-2,5-dimethylbenzamide.
| Compound Name | N-[(2,4-dimethylphenyl)-phenylmethyl]-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 133200142 |
| Molecular Formula | C24H25NO |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-[(2,4-dimethylphenyl)-phenylmethyl]-2,5-dimethylbenzamide |
| SMILES | Cc1ccc(C(NC(=O)c2cc(C)ccc2C)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C24H25NO/c1-16-11-13-21(19(4)14-16)23(20-8-6-5-7-9-20)25-24(26)22-15-17(2)10-12-18(22)3/h5-15,23H,1-4H3,(H,25,26) |
| InChIKey | QLANIEAKEYKJSE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |