C18H21NO2 — CID 2473869
N-[(1S)-1-(2-methoxyphenyl)ethyl]-2,5-dimethylbenzamide (PubChem CID 2473869) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is N-[(1S)-1-(2-methoxyphenyl)ethyl]-2,5-dimethylbenzamide.
| Compound Name | N-[(1S)-1-(2-methoxyphenyl)ethyl]-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 2473869 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N-[(1S)-1-(2-methoxyphenyl)ethyl]-2,5-dimethylbenzamide |
| SMILES | COc1ccccc1[C@H](C)NC(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C18H21NO2/c1-12-9-10-13(2)16(11-12)18(20)19-14(3)15-7-5-6-8-17(15)21-4/h5-11,14H,1-4H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | DDHUQGFDXQTTIC-AWEZNQCLSA-N |
| XLogP | 3.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |