C18H21N — CID 16773686
N-[(2,4-dimethylphenyl)-phenylmethyl]cyclopropanamine (PubChem CID 16773686) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)-phenylmethyl]cyclopropanamine.
| Compound Name | N-[(2,4-dimethylphenyl)-phenylmethyl]cyclopropanamine |
|---|---|
| PubChem CID | 16773686 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | N-[(2,4-dimethylphenyl)-phenylmethyl]cyclopropanamine |
| SMILES | Cc1ccc(C(NC2CC2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C18H21N/c1-13-8-11-17(14(2)12-13)18(19-16-9-10-16)15-6-4-3-5-7-15/h3-8,11-12,16,18-19H,9-10H2,1-2H3 |
| InChIKey | ZBZIQZJEMXVWLQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |