C19H23NS — CID 103779604
N-[(2,5-dimethylphenyl)-phenylmethyl]thiolan-3-amine (PubChem CID 103779604) has the molecular formula C19H23NS and a molecular weight of 297.47 g/mol. Its IUPAC name is N-[(2,5-dimethylphenyl)-phenylmethyl]thiolan-3-amine.
| Compound Name | N-[(2,5-dimethylphenyl)-phenylmethyl]thiolan-3-amine |
|---|---|
| PubChem CID | 103779604 |
| Molecular Formula | C19H23NS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-[(2,5-dimethylphenyl)-phenylmethyl]thiolan-3-amine |
| SMILES | Cc1ccc(C)c(C(NC2CCSC2)c2ccccc2)c1 |
| InChI | InChI=1S/C19H23NS/c1-14-8-9-15(2)18(12-14)19(16-6-4-3-5-7-16)20-17-10-11-21-13-17/h3-9,12,17,19-20H,10-11,13H2,1-2H3 |
| InChIKey | ARKQVOKVRHWFNP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |