C16H16F2N2S — CID 97322218
(3R)-N-[(R)-(2,5-difluorophenyl)-pyridin-4-ylmethyl]thiolan-3-amine (PubChem CID 97322218) has the molecular formula C16H16F2N2S and a molecular weight of 306.38 g/mol. Its IUPAC name is (3R)-N-[(R)-(2,5-difluorophenyl)-pyridin-4-ylmethyl]thiolan-3-amine.
| Compound Name | (3R)-N-[(R)-(2,5-difluorophenyl)-pyridin-4-ylmethyl]thiolan-3-amine |
|---|---|
| PubChem CID | 97322218 |
| Molecular Formula | C16H16F2N2S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (3R)-N-[(R)-(2,5-difluorophenyl)-pyridin-4-ylmethyl]thiolan-3-amine |
| SMILES | Fc1ccc(F)c([C@H](N[C@@H]2CCSC2)c2ccncc2)c1 |
| InChI | InChI=1S/C16H16F2N2S/c17-12-1-2-15(18)14(9-12)16(11-3-6-19-7-4-11)20-13-5-8-21-10-13/h1-4,6-7,9,13,16,20H,5,8,10H2/t13-,16-/m1/s1 |
| InChIKey | HOEWOYOENISKMA-CZUORRHYSA-N |
| XLogP | 3.54 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |