C10H13FN2S — CID 103062345
4-fluoro-2-N-(thiolan-3-yl)benzene-1,2-diamine (PubChem CID 103062345) has the molecular formula C10H13FN2S and a molecular weight of 212.29 g/mol. Its IUPAC name is 4-fluoro-2-N-(thiolan-3-yl)benzene-1,2-diamine.
| Compound Name | 4-fluoro-2-N-(thiolan-3-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 103062345 |
| Molecular Formula | C10H13FN2S |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 4-fluoro-2-N-(thiolan-3-yl)benzene-1,2-diamine |
| SMILES | Nc1ccc(F)cc1NC1CCSC1 |
| InChI | InChI=1S/C10H13FN2S/c11-7-1-2-9(12)10(5-7)13-8-3-4-14-6-8/h1-2,5,8,13H,3-4,6,12H2 |
| InChIKey | ZNTBZCBXVWIWDW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|