C11H11FN2S2 — CID 103063774
5-fluoro-N-(thiolan-3-yl)-1,3-benzothiazol-2-amine (PubChem CID 103063774) has the molecular formula C11H11FN2S2 and a molecular weight of 254.35 g/mol. Its IUPAC name is 5-fluoro-N-(thiolan-3-yl)-1,3-benzothiazol-2-amine.
| Compound Name | 5-fluoro-N-(thiolan-3-yl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 103063774 |
| Molecular Formula | C11H11FN2S2 |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 5-fluoro-N-(thiolan-3-yl)-1,3-benzothiazol-2-amine |
| SMILES | Fc1ccc2sc(NC3CCSC3)nc2c1 |
| InChI | InChI=1S/C11H11FN2S2/c12-7-1-2-10-9(5-7)14-11(16-10)13-8-3-4-15-6-8/h1-2,5,8H,3-4,6H2,(H,13,14) |
| InChIKey | HIYBEGSELPKAAY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |