C12H13FN2S2 — CID 66445630
5-fluoro-2-(thiomorpholin-3-ylmethyl)-1,3-benzothiazole (PubChem CID 66445630) has the molecular formula C12H13FN2S2 and a molecular weight of 268.38 g/mol. Its IUPAC name is 5-fluoro-2-(thiomorpholin-3-ylmethyl)-1,3-benzothiazole.
| Compound Name | 5-fluoro-2-(thiomorpholin-3-ylmethyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 66445630 |
| Molecular Formula | C12H13FN2S2 |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 5-fluoro-2-(thiomorpholin-3-ylmethyl)-1,3-benzothiazole |
| SMILES | Fc1ccc2sc(CC3CSCCN3)nc2c1 |
| InChI | InChI=1S/C12H13FN2S2/c13-8-1-2-11-10(5-8)15-12(17-11)6-9-7-16-4-3-14-9/h1-2,5,9,14H,3-4,6-7H2 |
| InChIKey | YVARKBWFJPWDKM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |