C11H13N3S2 — CID 66443080
2-(thiomorpholin-3-ylmethyl)-[1,3]thiazolo[4,5-c]pyridine (PubChem CID 66443080) has the molecular formula C11H13N3S2 and a molecular weight of 251.38 g/mol. Its IUPAC name is 2-(thiomorpholin-3-ylmethyl)-[1,3]thiazolo[4,5-c]pyridine.
| Compound Name | 2-(thiomorpholin-3-ylmethyl)-[1,3]thiazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 66443080 |
| Molecular Formula | C11H13N3S2 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 2-(thiomorpholin-3-ylmethyl)-[1,3]thiazolo[4,5-c]pyridine |
| SMILES | c1cc2sc(CC3CSCCN3)nc2cn1 |
| InChI | InChI=1S/C11H13N3S2/c1-2-12-6-9-10(1)16-11(14-9)5-8-7-15-4-3-13-8/h1-2,6,8,13H,3-5,7H2 |
| InChIKey | HBAKXJLILCJPIV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |