C13H16FNS — CID 115889550
N-(6-fluoro-2,3-dihydro-1H-inden-1-yl)thiolan-3-amine (PubChem CID 115889550) has the molecular formula C13H16FNS and a molecular weight of 237.34 g/mol. Its IUPAC name is N-(6-fluoro-2,3-dihydro-1H-inden-1-yl)thiolan-3-amine.
| Compound Name | N-(6-fluoro-2,3-dihydro-1H-inden-1-yl)thiolan-3-amine |
|---|---|
| PubChem CID | 115889550 |
| Molecular Formula | C13H16FNS |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | N-(6-fluoro-2,3-dihydro-1H-inden-1-yl)thiolan-3-amine |
| SMILES | Fc1ccc2c(c1)C(NC1CCSC1)CC2 |
| InChI | InChI=1S/C13H16FNS/c14-10-3-1-9-2-4-13(12(9)7-10)15-11-5-6-16-8-11/h1,3,7,11,13,15H,2,4-6,8H2 |
| InChIKey | SPHHJVAIDDQQLP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |