C15H21NS2 — CID 131929126
N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,4-dithiepan-6-amine (PubChem CID 131929126) has the molecular formula C15H21NS2 and a molecular weight of 279.47 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,4-dithiepan-6-amine.
| Compound Name | N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,4-dithiepan-6-amine |
|---|---|
| PubChem CID | 131929126 |
| Molecular Formula | C15H21NS2 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,4-dithiepan-6-amine |
| SMILES | c1ccc2c(c1)CCCC2NC1CSCCSC1 |
| InChI | InChI=1S/C15H21NS2/c1-2-6-14-12(4-1)5-3-7-15(14)16-13-10-17-8-9-18-11-13/h1-2,4,6,13,15-16H,3,5,7-11H2 |
| InChIKey | VJXPPBFSAYMRNI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |