C20H31N — CID 115998636
N-(3,3,5,5-tetramethylcyclohexyl)-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 115998636) has the molecular formula C20H31N and a molecular weight of 285.47 g/mol. Its IUPAC name is N-(3,3,5,5-tetramethylcyclohexyl)-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | N-(3,3,5,5-tetramethylcyclohexyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 115998636 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | N-(3,3,5,5-tetramethylcyclohexyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CC1(C)CC(NC2CCCc3ccccc32)CC(C)(C)C1 |
| InChI | InChI=1S/C20H31N/c1-19(2)12-16(13-20(3,4)14-19)21-18-11-7-9-15-8-5-6-10-17(15)18/h5-6,8,10,16,18,21H,7,9,11-14H2,1-4H3 |
| InChIKey | LSQQCNABULWDDE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |