C13H17N — CID 75488646
N-cyclopropyl-6-methyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 75488646) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is N-cyclopropyl-6-methyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-cyclopropyl-6-methyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 75488646 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | N-cyclopropyl-6-methyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | Cc1ccc2c(c1)C(NC1CC1)CC2 |
| InChI | InChI=1S/C13H17N/c1-9-2-3-10-4-7-13(12(10)8-9)14-11-5-6-11/h2-3,8,11,13-14H,4-7H2,1H3 |
| InChIKey | KKPUUCTYFLQDFL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |