C10H13IN2S — CID 103062329
2-iodo-1-N-(thiolan-3-yl)benzene-1,4-diamine (PubChem CID 103062329) has the molecular formula C10H13IN2S and a molecular weight of 320.20 g/mol. Its IUPAC name is 2-iodo-1-N-(thiolan-3-yl)benzene-1,4-diamine.
| Compound Name | 2-iodo-1-N-(thiolan-3-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 103062329 |
| Molecular Formula | C10H13IN2S |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 2-iodo-1-N-(thiolan-3-yl)benzene-1,4-diamine |
| SMILES | Nc1ccc(NC2CCSC2)c(I)c1 |
| InChI | InChI=1S/C10H13IN2S/c11-9-5-7(12)1-2-10(9)13-8-3-4-14-6-8/h1-2,5,8,13H,3-4,6,12H2 |
| InChIKey | WVGJRQJVOOSFBZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|