C13H20N2S — CID 43676939
4-N,4-N,2-trimethyl-1-N-(thiolan-3-yl)benzene-1,4-diamine (PubChem CID 43676939) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is 4-N,4-N,2-trimethyl-1-N-(thiolan-3-yl)benzene-1,4-diamine.
| Compound Name | 4-N,4-N,2-trimethyl-1-N-(thiolan-3-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 43676939 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 4-N,4-N,2-trimethyl-1-N-(thiolan-3-yl)benzene-1,4-diamine |
| SMILES | Cc1cc(N(C)C)ccc1NC1CCSC1 |
| InChI | InChI=1S/C13H20N2S/c1-10-8-12(15(2)3)4-5-13(10)14-11-6-7-16-9-11/h4-5,8,11,14H,6-7,9H2,1-3H3 |
| InChIKey | ZWODJAGPUVBEKZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|