C14H19NO2S — CID 62871262
methyl 3-methyl-4-(thian-3-ylamino)benzoate (PubChem CID 62871262) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is methyl 3-methyl-4-(thian-3-ylamino)benzoate.
| Compound Name | methyl 3-methyl-4-(thian-3-ylamino)benzoate |
|---|---|
| PubChem CID | 62871262 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | methyl 3-methyl-4-(thian-3-ylamino)benzoate |
| SMILES | COC(=O)c1ccc(NC2CCCSC2)c(C)c1 |
| InChI | InChI=1S/C14H19NO2S/c1-10-8-11(14(16)17-2)5-6-13(10)15-12-4-3-7-18-9-12/h5-6,8,12,15H,3-4,7,9H2,1-2H3 |
| InChIKey | PCOSMWVXPOJWAL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |