methyl 4-[(3,5-dimethylcyclohexyl)amino]-3-methylbenzoate

C17H25NO2 — CID 64752950

IUPACmethyl 4-[(3,5-dimethylcyclohexyl)amino]-3-methylbenzoate
SMILESCOC(=O)c1ccc(NC2CC(C)CC(C)C2)c(C)c1
InChIInChI=1S/C17H25NO2/c1-11-7-12(2)9-15(8-11)18-16-6-5-14(10-13(16)3)17(19)20-4/h5-6,10-12,15,18H,7-9H2,1-4H3
InChIKeyNOEOUKLNAANUCZ-UHFFFAOYSA-N
MW275.39 g/mol
LogP4.02
Rot. Bonds3

About methyl 4-[(3,5-dimethylcyclohexyl)amino]-3-methylbenzoate

methyl 4-[(3,5-dimethylcyclohexyl)amino]-3-methylbenzoate (PubChem CID 64752950) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is methyl 4-[(3,5-dimethylcyclohexyl)amino]-3-methylbenzoate.

Molecular Properties

Compound Namemethyl 4-[(3,5-dimethylcyclohexyl)amino]-3-methylbenzoate
PubChem CID64752950
Molecular FormulaC17H25NO2
Molecular Weight275.39 g/mol
Exact Mass275.19
IUPAC Namemethyl 4-[(3,5-dimethylcyclohexyl)amino]-3-methylbenzoate
SMILESCOC(=O)c1ccc(NC2CC(C)CC(C)C2)c(C)c1
InChIInChI=1S/C17H25NO2/c1-11-7-12(2)9-15(8-11)18-16-6-5-14(10-13(16)3)17(19)20-4/h5-6,10-12,15,18H,7-9H2,1-4H3
InChIKeyNOEOUKLNAANUCZ-UHFFFAOYSA-N
XLogP4.02
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.39
LogP ≤ 54.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 4-[(3,5-dimethylcyclohexyl)amino]-3-methylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[(3,5-dimethylcyclohexyl)amino]-3-methylbenzoate?
The IUPAC name of methyl 4-[(3,5-dimethylcyclohexyl)amino]-3-methylbenzoate (CID 64752950) is methyl 4-[(3,5-dimethylcyclohexyl)amino]-3-methylbenzoate.
What is the SMILES notation for methyl 4-[(3,5-dimethylcyclohexyl)amino]-3-methylbenzoate?
The canonical SMILES for methyl 4-[(3,5-dimethylcyclohexyl)amino]-3-methylbenzoate is COC(=O)c1ccc(NC2CC(C)CC(C)C2)c(C)c1.
What is the InChIKey of methyl 4-[(3,5-dimethylcyclohexyl)amino]-3-methylbenzoate?
The InChIKey is NOEOUKLNAANUCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO2/c1-11-7-12(2)9-15(8-11)18-16-6-5-14(10-13(16)3)17(19)20-4/h5-6,10-12,15,18H,7-9H2,1-4H3.
What are the key properties of methyl 4-[(3,5-dimethylcyclohexyl)amino]-3-methylbenzoate?
methyl 4-[(3,5-dimethylcyclohexyl)amino]-3-methylbenzoate has a molecular weight of 275.39 g/mol, XLogP of 4.02, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(3,5-dimethylcyclohexyl)amino]-3-methylbenzoate is sourced from PubChem (CID 64752950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).