C15H22IN — CID 64752738
N-(3,5-dimethylcyclohexyl)-4-iodo-2-methylaniline (PubChem CID 64752738) has the molecular formula C15H22IN and a molecular weight of 343.25 g/mol. Its IUPAC name is N-(3,5-dimethylcyclohexyl)-4-iodo-2-methylaniline.
| Compound Name | N-(3,5-dimethylcyclohexyl)-4-iodo-2-methylaniline |
|---|---|
| PubChem CID | 64752738 |
| Molecular Formula | C15H22IN |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N-(3,5-dimethylcyclohexyl)-4-iodo-2-methylaniline |
| SMILES | Cc1cc(I)ccc1NC1CC(C)CC(C)C1 |
| InChI | InChI=1S/C15H22IN/c1-10-6-11(2)8-14(7-10)17-15-5-4-13(16)9-12(15)3/h4-5,9-11,14,17H,6-8H2,1-3H3 |
| InChIKey | AXMZYDOVKRAURX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|