C12H17N3O2S — CID 114195380
methyl 2-amino-5-(thian-3-ylamino)pyridine-4-carboxylate (PubChem CID 114195380) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is methyl 2-amino-5-(thian-3-ylamino)pyridine-4-carboxylate.
| Compound Name | methyl 2-amino-5-(thian-3-ylamino)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 114195380 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | methyl 2-amino-5-(thian-3-ylamino)pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(N)ncc1NC1CCCSC1 |
| InChI | InChI=1S/C12H17N3O2S/c1-17-12(16)9-5-11(13)14-6-10(9)15-8-3-2-4-18-7-8/h5-6,8,15H,2-4,7H2,1H3,(H2,13,14) |
| InChIKey | UVKFZCMDEUGLQV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |