C17H19NO2S2 — CID 58869759
methyl 5-phenyl-2-(thian-3-ylamino)thiophene-3-carboxylate (PubChem CID 58869759) has the molecular formula C17H19NO2S2 and a molecular weight of 333.48 g/mol. Its IUPAC name is methyl 5-phenyl-2-(thian-3-ylamino)thiophene-3-carboxylate.
| Compound Name | methyl 5-phenyl-2-(thian-3-ylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 58869759 |
| Molecular Formula | C17H19NO2S2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | methyl 5-phenyl-2-(thian-3-ylamino)thiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)sc1NC1CCCSC1 |
| InChI | InChI=1S/C17H19NO2S2/c1-20-17(19)14-10-15(12-6-3-2-4-7-12)22-16(14)18-13-8-5-9-21-11-13/h2-4,6-7,10,13,18H,5,8-9,11H2,1H3 |
| InChIKey | FIUZRORNWYNPQZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |