C25H24N4O3S2 — CID 133219186
N-[5-[[(2,4-dimethylphenyl)-phenylmethyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide (PubChem CID 133219186) has the molecular formula C25H24N4O3S2 and a molecular weight of 492.63 g/mol. Its IUPAC name is N-[5-[[(2,4-dimethylphenyl)-phenylmethyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide.
| Compound Name | N-[5-[[(2,4-dimethylphenyl)-phenylmethyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 133219186 |
| Molecular Formula | C25H24N4O3S2 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | N-[5-[[(2,4-dimethylphenyl)-phenylmethyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide |
| SMILES | Cc1ccc(C(NS(=O)(=O)c2nnc(NC(=O)c3ccccc3C)s2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C25H24N4O3S2/c1-16-13-14-20(18(3)15-16)22(19-10-5-4-6-11-19)29-34(31,32)25-28-27-24(33-25)26-23(30)21-12-8-7-9-17(21)2/h4-15,22,29H,1-3H3,(H,26,27,30) |
| InChIKey | HIFVOCWRFKQEDU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|