C20H22N4O3S2 — CID 100626439
2-methyl-N-[5-[[(S)-(3-methylphenyl)-phenylmethyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 100626439) has the molecular formula C20H22N4O3S2 and a molecular weight of 430.56 g/mol. Its IUPAC name is 2-methyl-N-[5-[[(S)-(3-methylphenyl)-phenylmethyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | 2-methyl-N-[5-[[(S)-(3-methylphenyl)-phenylmethyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 100626439 |
| Molecular Formula | C20H22N4O3S2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 2-methyl-N-[5-[[(S)-(3-methylphenyl)-phenylmethyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | Cc1cccc([C@@H](NS(=O)(=O)c2nnc(NC(=O)C(C)C)s2)c2ccccc2)c1 |
| InChI | InChI=1S/C20H22N4O3S2/c1-13(2)18(25)21-19-22-23-20(28-19)29(26,27)24-17(15-9-5-4-6-10-15)16-11-7-8-14(3)12-16/h4-13,17,24H,1-3H3,(H,21,22,25)/t17-/m0/s1 |
| InChIKey | DLSAJUFHTYUFFS-KRWDZBQOSA-N |
| XLogP | 3.51 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|