C12H13FN4O3S2 — CID 100673658
N-[5-[(2-fluorophenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide (PubChem CID 100673658) has the molecular formula C12H13FN4O3S2 and a molecular weight of 344.39 g/mol. Its IUPAC name is N-[5-[(2-fluorophenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide.
| Compound Name | N-[5-[(2-fluorophenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 100673658 |
| Molecular Formula | C12H13FN4O3S2 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | N-[5-[(2-fluorophenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1nnc(S(=O)(=O)Nc2ccccc2F)s1 |
| InChI | InChI=1S/C12H13FN4O3S2/c1-7(2)10(18)14-11-15-16-12(21-11)22(19,20)17-9-6-4-3-5-8(9)13/h3-7,17H,1-2H3,(H,14,15,18) |
| InChIKey | CLCUHCKLDBEIST-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|