C25H29N3O6S — CID 67021759
N-[[3-(cyclopropylmethoxy)phenyl]-phenylmethyl]-3-[(2,4-dioxopyrimidin-1-yl)methoxy]propane-1-sulfonamide (PubChem CID 67021759) has the molecular formula C25H29N3O6S and a molecular weight of 499.59 g/mol. Its IUPAC name is N-[[3-(cyclopropylmethoxy)phenyl]-phenylmethyl]-3-[(2,4-dioxopyrimidin-1-yl)methoxy]propane-1-sulfonamide.
| Compound Name | N-[[3-(cyclopropylmethoxy)phenyl]-phenylmethyl]-3-[(2,4-dioxopyrimidin-1-yl)methoxy]propane-1-sulfonamide |
|---|---|
| PubChem CID | 67021759 |
| Molecular Formula | C25H29N3O6S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | N-[[3-(cyclopropylmethoxy)phenyl]-phenylmethyl]-3-[(2,4-dioxopyrimidin-1-yl)methoxy]propane-1-sulfonamide |
| SMILES | O=c1ccn(COCCCS(=O)(=O)NC(c2ccccc2)c2cccc(OCC3CC3)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C25H29N3O6S/c29-23-12-13-28(25(30)26-23)18-33-14-5-15-35(31,32)27-24(20-6-2-1-3-7-20)21-8-4-9-22(16-21)34-17-19-10-11-19/h1-4,6-9,12-13,16,19,24,27H,5,10-11,14-15,17-18H2,(H,26,29,30) |
| InChIKey | ZMVSYAHRWNAOGX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|