C22H30N2O6S — CID 58218424
1-[3-[2-[3-(cyclopropylmethoxy)phenyl]-2-methylpropyl]sulfonylpropoxymethyl]pyrimidine-2,4-dione (PubChem CID 58218424) has the molecular formula C22H30N2O6S and a molecular weight of 450.56 g/mol. Its IUPAC name is 1-[3-[2-[3-(cyclopropylmethoxy)phenyl]-2-methylpropyl]sulfonylpropoxymethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-[2-[3-(cyclopropylmethoxy)phenyl]-2-methylpropyl]sulfonylpropoxymethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58218424 |
| Molecular Formula | C22H30N2O6S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 1-[3-[2-[3-(cyclopropylmethoxy)phenyl]-2-methylpropyl]sulfonylpropoxymethyl]pyrimidine-2,4-dione |
| SMILES | CC(C)(CS(=O)(=O)CCCOCn1ccc(=O)[nH]c1=O)c1cccc(OCC2CC2)c1 |
| InChI | InChI=1S/C22H30N2O6S/c1-22(2,18-5-3-6-19(13-18)30-14-17-7-8-17)15-31(27,28)12-4-11-29-16-24-10-9-20(25)23-21(24)26/h3,5-6,9-10,13,17H,4,7-8,11-12,14-16H2,1-2H3,(H,23,25,26) |
| InChIKey | CXMUFLOFCBGPHP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|