C22H32N4O3 — CID 142399595
1-[5-[2-[1-[3-(cyclopropylmethoxy)phenyl]propyl]hydrazinyl]pentyl]pyrimidine-2,4-dione (PubChem CID 142399595) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 1-[5-[2-[1-[3-(cyclopropylmethoxy)phenyl]propyl]hydrazinyl]pentyl]pyrimidine-2,4-dione.
| Compound Name | 1-[5-[2-[1-[3-(cyclopropylmethoxy)phenyl]propyl]hydrazinyl]pentyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142399595 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 1-[5-[2-[1-[3-(cyclopropylmethoxy)phenyl]propyl]hydrazinyl]pentyl]pyrimidine-2,4-dione |
| SMILES | CCC(NNCCCCCn1ccc(=O)[nH]c1=O)c1cccc(OCC2CC2)c1 |
| InChI | InChI=1S/C22H32N4O3/c1-2-20(18-7-6-8-19(15-18)29-16-17-9-10-17)25-23-12-4-3-5-13-26-14-11-21(27)24-22(26)28/h6-8,11,14-15,17,20,23,25H,2-5,9-10,12-13,16H2,1H3,(H,24,27,28) |
| InChIKey | GTDFPDQVNHNDDF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|