C15H20N4O2 — CID 142399923
1-[3-[2-[(1S)-1-phenylethyl]hydrazinyl]propyl]pyrimidine-2,4-dione (PubChem CID 142399923) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-[3-[2-[(1S)-1-phenylethyl]hydrazinyl]propyl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-[2-[(1S)-1-phenylethyl]hydrazinyl]propyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142399923 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1-[3-[2-[(1S)-1-phenylethyl]hydrazinyl]propyl]pyrimidine-2,4-dione |
| SMILES | C[C@H](NNCCCn1ccc(=O)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C15H20N4O2/c1-12(13-6-3-2-4-7-13)18-16-9-5-10-19-11-8-14(20)17-15(19)21/h2-4,6-8,11-12,16,18H,5,9-10H2,1H3,(H,17,20,21)/t12-/m0/s1 |
| InChIKey | LHILDOMWZVOFKC-LBPRGKRZSA-N |
| XLogP | 0.78 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|