C16H21N3O2S — CID 143904449
1-[3-(1-phenylpropylamino)sulfanylpropyl]pyrimidine-2,4-dione (PubChem CID 143904449) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-[3-(1-phenylpropylamino)sulfanylpropyl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-(1-phenylpropylamino)sulfanylpropyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 143904449 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-[3-(1-phenylpropylamino)sulfanylpropyl]pyrimidine-2,4-dione |
| SMILES | CCC(NSCCCn1ccc(=O)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C16H21N3O2S/c1-2-14(13-7-4-3-5-8-13)18-22-12-6-10-19-11-9-15(20)17-16(19)21/h3-5,7-9,11,14,18H,2,6,10,12H2,1H3,(H,17,20,21) |
| InChIKey | JKVZQRBFWMTLBE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|