C17H19N3O5 — CID 108801666
ethyl 2-[3-(2,4-dioxopyrimidin-1-yl)propanoylamino]-2-phenylacetate (PubChem CID 108801666) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is ethyl 2-[3-(2,4-dioxopyrimidin-1-yl)propanoylamino]-2-phenylacetate.
| Compound Name | ethyl 2-[3-(2,4-dioxopyrimidin-1-yl)propanoylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 108801666 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | ethyl 2-[3-(2,4-dioxopyrimidin-1-yl)propanoylamino]-2-phenylacetate |
| SMILES | CCOC(=O)C(NC(=O)CCn1ccc(=O)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C17H19N3O5/c1-2-25-16(23)15(12-6-4-3-5-7-12)18-13(21)8-10-20-11-9-14(22)19-17(20)24/h3-7,9,11,15H,2,8,10H2,1H3,(H,18,21)(H,19,22,24) |
| InChIKey | BVUJWDLXGRJOJY-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |