C25H36FN5O3 — CID 142399513
1-[5-[2-[4-[3-(cyclopropylmethoxy)-4-fluorophenyl]-1-methylpiperidin-4-yl]hydrazinyl]pentyl]pyrimidine-2,4-dione (PubChem CID 142399513) has the molecular formula C25H36FN5O3 and a molecular weight of 473.59 g/mol. Its IUPAC name is 1-[5-[2-[4-[3-(cyclopropylmethoxy)-4-fluorophenyl]-1-methylpiperidin-4-yl]hydrazinyl]pentyl]pyrimidine-2,4-dione.
| Compound Name | 1-[5-[2-[4-[3-(cyclopropylmethoxy)-4-fluorophenyl]-1-methylpiperidin-4-yl]hydrazinyl]pentyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142399513 |
| Molecular Formula | C25H36FN5O3 |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | 1-[5-[2-[4-[3-(cyclopropylmethoxy)-4-fluorophenyl]-1-methylpiperidin-4-yl]hydrazinyl]pentyl]pyrimidine-2,4-dione |
| SMILES | CN1CCC(NNCCCCCn2ccc(=O)[nH]c2=O)(c2ccc(F)c(OCC3CC3)c2)CC1 |
| InChI | InChI=1S/C25H36FN5O3/c1-30-15-10-25(11-16-30,20-7-8-21(26)22(17-20)34-18-19-5-6-19)29-27-12-3-2-4-13-31-14-9-23(32)28-24(31)33/h7-9,14,17,19,27,29H,2-6,10-13,15-16,18H2,1H3,(H,28,32,33) |
| InChIKey | LAXNVYMGXAZLMK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|