C24H26FN5O4 — CID 46181526
1-[4-[3-[(1S)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-1-hydroxyethyl]-5-ethynyltriazol-4-yl]butyl]pyrimidine-2,4-dione (PubChem CID 46181526) has the molecular formula C24H26FN5O4 and a molecular weight of 467.50 g/mol. Its IUPAC name is 1-[4-[3-[(1S)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-1-hydroxyethyl]-5-ethynyltriazol-4-yl]butyl]pyrimidine-2,4-dione.
| Compound Name | 1-[4-[3-[(1S)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-1-hydroxyethyl]-5-ethynyltriazol-4-yl]butyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 46181526 |
| Molecular Formula | C24H26FN5O4 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 1-[4-[3-[(1S)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-1-hydroxyethyl]-5-ethynyltriazol-4-yl]butyl]pyrimidine-2,4-dione |
| SMILES | C#Cc1nnn([C@@](C)(O)c2ccc(F)c(OCC3CC3)c2)c1CCCCn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C24H26FN5O4/c1-3-19-20(6-4-5-12-29-13-11-22(31)26-23(29)32)30(28-27-19)24(2,33)17-9-10-18(25)21(14-17)34-15-16-7-8-16/h1,9-11,13-14,16,33H,4-8,12,15H2,2H3,(H,26,31,32)/t24-/m0/s1 |
| InChIKey | NIDMDGUUIJMXAZ-DEOSSOPVSA-N |
| XLogP | 1.77 |
| TPSA | 115.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|