C25H33FN4O4 — CID 118863570
3-[4-[3-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxybutyl]triazol-4-yl]butyl]piperidine-2,6-dione (PubChem CID 118863570) has the molecular formula C25H33FN4O4 and a molecular weight of 472.56 g/mol. Its IUPAC name is 3-[4-[3-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxybutyl]triazol-4-yl]butyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[3-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxybutyl]triazol-4-yl]butyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 118863570 |
| Molecular Formula | C25H33FN4O4 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 3-[4-[3-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxybutyl]triazol-4-yl]butyl]piperidine-2,6-dione |
| SMILES | CCC(O)(Cn1nncc1CCCCC1CCC(=O)NC1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C25H33FN4O4/c1-2-25(33,19-10-11-21(26)22(13-19)34-15-17-7-8-17)16-30-20(14-27-29-30)6-4-3-5-18-9-12-23(31)28-24(18)32/h10-11,13-14,17-18,33H,2-9,12,15-16H2,1H3,(H,28,31,32) |
| InChIKey | HGYZVNOEVHZWGR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|