C24H30FN5O3 — CID 139460601
3-[3-[3-[[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]methyl]triazol-4-yl]propylamino]piperidine-2,6-dione (PubChem CID 139460601) has the molecular formula C24H30FN5O3 and a molecular weight of 455.53 g/mol. Its IUPAC name is 3-[3-[3-[[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]methyl]triazol-4-yl]propylamino]piperidine-2,6-dione.
| Compound Name | 3-[3-[3-[[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]methyl]triazol-4-yl]propylamino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 139460601 |
| Molecular Formula | C24H30FN5O3 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 3-[3-[3-[[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]methyl]triazol-4-yl]propylamino]piperidine-2,6-dione |
| SMILES | O=C1CCC(NCCCc2cnnn2CC2(c3ccc(F)c(OCC4CC4)c3)CC2)C(=O)N1 |
| InChI | InChI=1S/C24H30FN5O3/c25-19-6-5-17(12-21(19)33-14-16-3-4-16)24(9-10-24)15-30-18(13-27-29-30)2-1-11-26-20-7-8-22(31)28-23(20)32/h5-6,12-13,16,20,26H,1-4,7-11,14-15H2,(H,28,31,32) |
| InChIKey | VANFFPJCRDLEDR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|