C24H36FN3O5 — CID 139460464
3-[3-[[3-[3-(cyclopropylmethoxy)-4-fluorophenyl]-1,3-dihydroxypentyl]-methylamino]propylamino]piperidine-2,6-dione (PubChem CID 139460464) has the molecular formula C24H36FN3O5 and a molecular weight of 465.57 g/mol. Its IUPAC name is 3-[3-[[3-[3-(cyclopropylmethoxy)-4-fluorophenyl]-1,3-dihydroxypentyl]-methylamino]propylamino]piperidine-2,6-dione.
| Compound Name | 3-[3-[[3-[3-(cyclopropylmethoxy)-4-fluorophenyl]-1,3-dihydroxypentyl]-methylamino]propylamino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 139460464 |
| Molecular Formula | C24H36FN3O5 |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | 3-[3-[[3-[3-(cyclopropylmethoxy)-4-fluorophenyl]-1,3-dihydroxypentyl]-methylamino]propylamino]piperidine-2,6-dione |
| SMILES | CCC(O)(CC(O)N(C)CCCNC1CCC(=O)NC1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C24H36FN3O5/c1-3-24(32,17-7-8-18(25)20(13-17)33-15-16-5-6-16)14-22(30)28(2)12-4-11-26-19-9-10-21(29)27-23(19)31/h7-8,13,16,19,22,26,30,32H,3-6,9-12,14-15H2,1-2H3,(H,27,29,31) |
| InChIKey | ZMXKMSABYNMCCC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|