C26H36FN5O4 — CID 90273490
3-[4-[3-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxybutyl]triazol-4-yl]butylamino]-3-methylpiperidine-2,6-dione (PubChem CID 90273490) has the molecular formula C26H36FN5O4 and a molecular weight of 501.60 g/mol. Its IUPAC name is 3-[4-[3-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxybutyl]triazol-4-yl]butylamino]-3-methylpiperidine-2,6-dione.
| Compound Name | 3-[4-[3-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxybutyl]triazol-4-yl]butylamino]-3-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 90273490 |
| Molecular Formula | C26H36FN5O4 |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | 3-[4-[3-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxybutyl]triazol-4-yl]butylamino]-3-methylpiperidine-2,6-dione |
| SMILES | CCC(O)(Cn1nncc1CCCCNC1(C)CCC(=O)NC1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C26H36FN5O4/c1-3-26(35,19-9-10-21(27)22(14-19)36-16-18-7-8-18)17-32-20(15-29-31-32)6-4-5-13-28-25(2)12-11-23(33)30-24(25)34/h9-10,14-15,18,28,35H,3-8,11-13,16-17H2,1-2H3,(H,30,33,34) |
| InChIKey | CUVRPXHHUUHDDC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|