C21H30FN3O3 — CID 70910105
(2S)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-1-[5-(4-hydroxybutyl)-3-methyl-1,2,4-triazol-1-yl]butan-2-ol (PubChem CID 70910105) has the molecular formula C21H30FN3O3 and a molecular weight of 391.49 g/mol. Its IUPAC name is (2S)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-1-[5-(4-hydroxybutyl)-3-methyl-1,2,4-triazol-1-yl]butan-2-ol.
| Compound Name | (2S)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-1-[5-(4-hydroxybutyl)-3-methyl-1,2,4-triazol-1-yl]butan-2-ol |
|---|---|
| PubChem CID | 70910105 |
| Molecular Formula | C21H30FN3O3 |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | (2S)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-1-[5-(4-hydroxybutyl)-3-methyl-1,2,4-triazol-1-yl]butan-2-ol |
| SMILES | CC[C@@](O)(Cn1nc(C)nc1CCCCO)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C21H30FN3O3/c1-3-21(27,14-25-20(6-4-5-11-26)23-15(2)24-25)17-9-10-18(22)19(12-17)28-13-16-7-8-16/h9-10,12,16,26-27H,3-8,11,13-14H2,1-2H3/t21-/m1/s1 |
| InChIKey | KRKOICZQQJMPIO-OAQYLSRUSA-N |
| XLogP | 3.13 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|