C26H36FN5O3 — CID 90277853
3-[4-[3-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]butyl]triazol-4-yl]butylamino]-3-methylpiperidine-2,6-dione (PubChem CID 90277853) has the molecular formula C26H36FN5O3 and a molecular weight of 485.60 g/mol. Its IUPAC name is 3-[4-[3-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]butyl]triazol-4-yl]butylamino]-3-methylpiperidine-2,6-dione.
| Compound Name | 3-[4-[3-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]butyl]triazol-4-yl]butylamino]-3-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 90277853 |
| Molecular Formula | C26H36FN5O3 |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | 3-[4-[3-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]butyl]triazol-4-yl]butylamino]-3-methylpiperidine-2,6-dione |
| SMILES | CC[C@@H](Cn1nncc1CCCCNC1(C)CCC(=O)NC1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C26H36FN5O3/c1-3-19(20-9-10-22(27)23(14-20)35-17-18-7-8-18)16-32-21(15-29-31-32)6-4-5-13-28-26(2)12-11-24(33)30-25(26)34/h9-10,14-15,18-19,28H,3-8,11-13,16-17H2,1-2H3,(H,30,33,34)/t19-,26?/m0/s1 |
| InChIKey | ZNKXKEJPUULBMI-SXMXNQBWSA-N |
| XLogP | 3.51 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|